4-Ethynyl-1-methyl-1H-imidazole - CAS 55384-94-6
Catalog: |
BB029020 |
Product Name: |
4-Ethynyl-1-methyl-1H-imidazole |
CAS: |
55384-94-6 |
Synonyms: |
4-ethynyl-1-methylimidazole; 4-ethynyl-1-methylimidazole |
IUPAC Name: | 4-ethynyl-1-methylimidazole |
Description: | 4-Ethynyl-1-methyl-1H-imidazole (CAS# 55384-94-6 ) is a useful research chemical. |
Molecular Weight: | 106.13 |
Molecular Formula: | C6H6N2 |
Canonical SMILES: | CN1C=C(N=C1)C#C |
InChI: | InChI=1S/C6H6N2/c1-3-6-4-8(2)5-7-6/h1,4-5H,2H3 |
InChI Key: | KHQAFOOAJHOTDD-UHFFFAOYSA-N |
LogP: | 0.40140 |
Publication Number | Title | Priority Date |
AU-2017337946-A1 | Tetrahydropyridine derivatives and their use as antibacterial agents | 20160928 |
AU-2017337946-B2 | Tetrahydropyridine derivatives and their use as antibacterial agents | 20160928 |
EP-3519387-A1 | Tetrahydropyridine derivatives and their use as antibacterial agents | 20160928 |
JP-2019534252-A | Tetrahydropyridine derivatives and their use as antibacterial agents | 20160928 |
KR-20190047127-A | Tetrahydropyridine Derivatives and Their Use as Antibacterial Agents | 20160928 |
Complexity: | 122 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 106.0530982 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 106.0530982 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Imidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS