4'-Ethyl-4-biphenylboronic Acid - CAS 153035-62-2
Catalog: |
BB010846 |
Product Name: |
4'-Ethyl-4-biphenylboronic Acid |
CAS: |
153035-62-2 |
Synonyms: |
[4-(4-ethylphenyl)phenyl]boronic acid; [4-(4-ethylphenyl)phenyl]boronic acid |
IUPAC Name: | [4-(4-ethylphenyl)phenyl]boronic acid |
Description: | 4'-Ethyl-4-biphenylboronic Acid (CAS# 153035-62-2) is a useful research chemical. |
Molecular Weight: | 226.08 |
Molecular Formula: | C14H15O2B |
Canonical SMILES: | B(C1=CC=C(C=C1)C2=CC=C(C=C2)CC)(O)O |
InChI: | InChI=1S/C14H15BO2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h3-10,16-17H,2H2,1H3 |
InChI Key: | DEUOTLGHQXNPJY-UHFFFAOYSA-N |
Boiling Point: | 401.8 °C at 760 mmHg |
Density: | 1.13 g/cm3 |
Storage: | Inert atmosphere. Keep cold. |
MDL: | MFCD04038068 |
LogP: | 1.59580 |
Precautionary Statement: | P280-P305+P351+P338 |
Publication Number | Title | Priority Date |
JP-2018519354-A | Pyridin-3-ylacetic acid derivatives as inhibitors of human immunodeficiency virus replication | 20150709 |
US-2018170904-A1 | Pyridin-3-yl acetic acid derivatives as inhibitors of human immunodeficiency virus replication | 20150709 |
JP-2016147852-A | Liquid crystal compound and liquid crystal composition using the same | 20150130 |
JP-6143389-B2 | Liquid crystal compound and liquid crystal composition using the same | 20150130 |
US-10113116-B2 | Liquid crystal compound and liquid crystal composition employing the same | 20150130 |
Complexity: | 216 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 226.1165099 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 226.1165099 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 40.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Boronic Acids and Esters
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS