4-Cyanopyridine-2-carboxaldehyde - CAS 116308-38-4
Catalog: |
BB003736 |
Product Name: |
4-Cyanopyridine-2-carboxaldehyde |
CAS: |
116308-38-4 |
Synonyms: |
2-formyl-4-pyridinecarbonitrile; 2-formylpyridine-4-carbonitrile |
IUPAC Name: | 2-formylpyridine-4-carbonitrile |
Description: | 4-Cyanopyridine-2-carboxaldehyde (CAS# 116308-38-4 ) is a useful research chemical. |
Molecular Weight: | 132.12 |
Molecular Formula: | C7H4N2O |
Canonical SMILES: | C1=CN=C(C=C1C#N)C=O |
InChI: | InChI=1S/C7H4N2O/c8-4-6-1-2-9-7(3-6)5-10/h1-3,5H |
InChI Key: | MKTLVFRYWOEUPJ-UHFFFAOYSA-N |
LogP: | 0.76578 |
Publication Number | Title | Priority Date |
US-2021238139-A1 | Modulators of tryptophan catabolism | 20180601 |
EP-3143055-A2 | Polymers functionalized with protected oxime compounds containing a cyano group | 20140515 |
WO-2015175280-A2 | Polymers functionalized with protected oxime compounds containing a cyano group | 20140515 |
EP-2017275-A1 | Benzisoxazole compound | 20060428 |
JP-WO2007126041-A1 | Benzisoxazole compounds | 20060428 |
Complexity: | 170 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 132.032362755 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 132.032362755 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 53.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS