4-(Chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole - CAS 137090-44-9
Catalog: |
BB008511 |
Product Name: |
4-(Chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole |
CAS: |
137090-44-9 |
Synonyms: |
4-(chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole |
IUPAC Name: | 4-(chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole |
Description: | 4-(Chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole (CAS# 137090-44-9) is a useful research chemical. |
Molecular Weight: | 221.68 |
Molecular Formula: | C12H12ClNO |
Canonical SMILES: | CC1=CC=C(C=C1)C2=NC(=C(O2)C)CCl |
InChI: | InChI=1S/C12H12ClNO/c1-8-3-5-10(6-4-8)12-14-11(7-13)9(2)15-12/h3-6H,7H2,1-2H3 |
InChI Key: | DQTOUJFUSUPWOK-UHFFFAOYSA-N |
Boiling Point: | 350.6 ℃ at 760 mmHg |
Purity: | 95 % |
Density: | 1.16 g/cm3 |
MDL: | MFCD08059927 |
LogP: | 3.69720 |
Publication Number | Title | Priority Date |
US-2011130377-A1 | Substituted aryloxazoles and their use | 20070727 |
US-2014162981-A1 | Substituted aryloxazoles and their use | 20070727 |
US-8440700-B2 | Substituted aryloxazoles and their use | 20070727 |
US-9095582-B2 | Substituted aryloxazoles and their use | 20070727 |
WO-2008117982-A1 | Heterocyclic carboxylic acid derivatives and pharmaceutical composition for inhibiting lipid accumulation containing same | 20070328 |
Complexity: | 204 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 221.0607417 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 221.0607417 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxazole/Thiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS