4-Chloro-6-methyl-2-(methylthio)pyrimidine - CAS 17119-73-2
Catalog: |
BB012726 |
Product Name: |
4-Chloro-6-methyl-2-(methylthio)pyrimidine |
CAS: |
17119-73-2 |
Synonyms: |
4-chloro-6-methyl-2-(methylthio)pyrimidine; 4-chloro-6-methyl-2-methylsulfanylpyrimidine |
IUPAC Name: | 4-chloro-6-methyl-2-methylsulfanylpyrimidine |
Description: | 4-Chloro-6-methyl-2-(methylthio)pyrimidine has been used in the synthesis of 4-chloro-2-(3,5-dimethyl-1h-pyrazol-1-yl)-6-methylpyrimidine. |
Molecular Weight: | 174.65 |
Molecular Formula: | C6H7ClN2S |
Canonical SMILES: | CC1=CC(=NC(=N1)SC)Cl |
InChI: | InChI=1S/C6H7ClN2S/c1-4-3-5(7)9-6(8-4)10-2/h3H,1-2H3 |
InChI Key: | ALMBOXQFPLQVLF-UHFFFAOYSA-N |
Boiling Point: | 266.2 °C at 760 mmHg |
Density: | 1.3 g/cm3 |
MDL: | MFCD00023233 |
LogP: | 2.16030 |
GHS Hazard Statement: | H302 (97.44%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2019224096-A1 | Heterocondensed pyridones compounds and their use as idh inhibitors | 20180521 |
AU-2019273599-A1 | Heterocondensed pyridones compounds and their use as IDH inhibitors | 20180521 |
AU-2019273599-A2 | Heterocondensed pyridones compounds and their use as IDH inhibitors | 20180521 |
CN-112469719-A | Heterocondensed pyridone compounds and their use as IDH inhibitors | 20180521 |
EP-3797107-A1 | Heterocondensed pyridones compounds and their use as idh inhibitors | 20180521 |
Complexity: | 112 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.0018471 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.0018471 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 51.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS