4-Chloro-5-nitrobenzimidazole - CAS 1360891-62-8
Catalog: |
BB008282 |
Product Name: |
4-Chloro-5-nitrobenzimidazole |
CAS: |
1360891-62-8 |
Synonyms: |
4-chloro-5-nitro-1H-benzimidazole; 4-chloro-5-nitro-1H-benzimidazole |
IUPAC Name: | 4-chloro-5-nitro-1H-benzimidazole |
Description: | 4-Chloro-5-nitrobenzimidazole (CAS# 1360891-62-8) is a useful research chemical. |
Molecular Weight: | 197.58 |
Molecular Formula: | C7H4ClN3O2 |
Canonical SMILES: | C1=CC(=C(C2=C1NC=N2)Cl)[N+](=O)[O-] |
InChI: | InChI=1S/C7H4ClN3O2/c8-6-5(11(12)13)2-1-4-7(6)10-3-9-4/h1-3H,(H,9,10) |
InChI Key: | IJZUCIHBALRZOK-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2018218965-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
AU-2018218965-B2 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
CA-3049643-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
EP-3580208-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
JP-2020506197-A | Novel heterocyclic compound, production method thereof and pharmaceutical composition containing the same | 20170207 |
Complexity: | 220 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.9992041 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.9992041 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 74.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzimidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS