4-Chloro-5-methoxybenzimidazole - CAS 1360953-02-1
Catalog: |
BB008294 |
Product Name: |
4-Chloro-5-methoxybenzimidazole |
CAS: |
1360953-02-1 |
Synonyms: |
4-chloro-5-methoxy-1H-benzimidazole; 4-chloro-5-methoxy-1H-benzimidazole |
IUPAC Name: | 4-chloro-5-methoxy-1H-benzimidazole |
Description: | 4-Chloro-5-methoxybenzimidazole (CAS# 1360953-02-1 ) is a useful research chemical. |
Molecular Weight: | 182.61 |
Molecular Formula: | C8H7ClN2O |
Canonical SMILES: | COC1=C(C2=C(C=C1)NC=N2)Cl |
InChI: | InChI=1S/C8H7ClN2O/c1-12-6-3-2-5-8(7(6)9)11-4-10-5/h2-4H,1H3,(H,10,11) |
InChI Key: | VXELIBRJQFMUNW-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2018218965-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
AU-2018218965-B2 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
CA-3049643-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
CN-110191882-A | Novel heterocyclic compounds, preparation method and the pharmaceutical composition comprising it | 20170207 |
EP-3580208-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 182.0246905 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 182.0246905 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzimidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS