4-Chloro-5-fluoroquinazoline - CAS 16499-60-8
Catalog: |
BB012155 |
Product Name: |
4-Chloro-5-fluoroquinazoline |
CAS: |
16499-60-8 |
Synonyms: |
4-chloro-5-fluoroquinazoline; 4-chloro-5-fluoroquinazoline |
IUPAC Name: | 4-chloro-5-fluoroquinazoline |
Description: | 4-Chloro-5-fluoroquinazoline (CAS# 16499-60-8) is a useful research chemical. |
Molecular Weight: | 182.58 |
Molecular Formula: | C8H4ClFN2 |
Canonical SMILES: | C1=CC2=C(C(=C1)F)C(=NC=N2)Cl |
InChI: | InChI=1S/C8H4ClFN2/c9-8-7-5(10)2-1-3-6(7)11-4-12-8/h1-4H |
InChI Key: | NRVNUZHSKMEHOT-UHFFFAOYSA-N |
Boiling Point: | 284.9 °C at 760 mmHg |
Density: | 1.447 g/cm3 |
LogP: | 2.42230 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020352942-A1 | Dosage forms and regimens for amino acid compounds | 20190408 |
WO-2020210404-A1 | Dosage forms and regimens for amino acid compounds | 20190408 |
WO-2020163193-A1 | Bicyclic ether o-glycoprotein-2-acetamido-2-deoxy-3-d-glucopyranosidase inhibitors | 20190204 |
TW-202045501-A | Bicyclic ether o-glycoprotein-2-acetamido-2-de oxy-3-d-glucopyranosidase inhibitors | 20190204 |
US-2020109141-A1 | Amino acid compounds and methods of use | 20181008 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 182.0047040 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 182.0047040 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS