4-Chloro-3-pyridinesulfonyl Chloride - CAS 33263-44-4
Catalog: |
BB021639 |
Product Name: |
4-Chloro-3-pyridinesulfonyl Chloride |
CAS: |
33263-44-4 |
Synonyms: |
4-chloro-3-pyridinesulfonyl chloride; 4-chloropyridine-3-sulfonyl chloride |
IUPAC Name: | 4-chloropyridine-3-sulfonyl chloride |
Description: | 4-Chloropyridine-3-sulfonyl Chloride can be used for antiinflammatory properties. |
Molecular Weight: | 212.05 |
Molecular Formula: | C5H3Cl2NO2S |
Canonical SMILES: | C1=CN=CC(=C1Cl)S(=O)(=O)Cl |
InChI: | InChI=1S/C5H3Cl2NO2S/c6-4-1-2-8-3-5(4)11(7,9)10/h1-3H |
InChI Key: | KCNWYJPUGJYMNO-UHFFFAOYSA-N |
LogP: | 2.74330 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P330, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021002473-A1 | Nrf2-activating compound | 20190703 |
WO-2020117634-A1 | Ire1 small molecule inhibitors | 20181203 |
WO-2020117635-A1 | Ire1 small molecule inhibitors | 20181203 |
EP-3891130-A1 | Ire1 small molecule inhibitors | 20181203 |
EP-3891137-A1 | Ire1 small molecule inhibitors | 20181203 |
Complexity: | 223 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 210.9261549 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 210.9261549 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS