4-Chloro-2-trichloromethyl-quinoline - CAS 35871-17-1
Catalog: |
BB022780 |
Product Name: |
4-Chloro-2-trichloromethyl-quinoline |
CAS: |
35871-17-1 |
Synonyms: |
4-chloro-2-(trichloromethyl)quinoline |
IUPAC Name: | 4-chloro-2-(trichloromethyl)quinoline |
Description: | 4-Chloro-2-trichloromethyl-quinoline (CAS# 35871-17-1) is a useful research chemical. |
Molecular Weight: | 280.97 |
Molecular Formula: | C10H5Cl4N |
Canonical SMILES: | C1=CC=C2C(=C1)C(=CC(=N2)C(Cl)(Cl)Cl)Cl |
InChI: | InChI=1S/C10H5Cl4N/c11-7-5-9(10(12,13)14)15-8-4-2-1-3-6(7)8/h1-5H |
InChI Key: | AAAIMZMBCBBTQL-UHFFFAOYSA-N |
Boiling Point: | 331.9 °C at 760 mmHg |
Density: | 1.56 g/cm3 |
LogP: | 4.71490 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P316, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-0111329-B1 | Fluoromethyl quinoline derivatives and their preparation | 19821211 |
EP-0113432-A1 | Chloromethyl quinoline derivatives, process for their preparation and their use | 19821202 |
EP-0113432-B1 | Chloromethyl quinoline derivatives, process for their preparation and their use | 19821202 |
HU-191508-B | Process for preparing new chloromethyl-quinoline derivatives | 19821202 |
SU-1516010-A3 | Method of producing chloromethylquinoline derivatives | 19821202 |
Complexity: | 228 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 280.91466 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 278.91761 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS