4-Chloro-2,6-dimethyl-3-nitropyridine - CAS 15513-48-1
Catalog: |
BB011090 |
Product Name: |
4-Chloro-2,6-dimethyl-3-nitropyridine |
CAS: |
15513-48-1 |
Synonyms: |
4-chloro-2,6-dimethyl-3-nitropyridine; 4-chloro-2,6-dimethyl-3-nitropyridine |
IUPAC Name: | 4-chloro-2,6-dimethyl-3-nitropyridine |
Description: | 4-Chloro-2,6-dimethyl-3-nitropyridine (CAS# 15513-48-1) is a useful research chemical. |
Molecular Weight: | 186.60 |
Molecular Formula: | C7H7ClN2O2 |
Canonical SMILES: | CC1=NC(=C(C(=C1)Cl)[N+](=O)[O-])C |
InChI: | InChI=1S/C7H7ClN2O2/c1-4-3-6(8)7(10(11)12)5(2)9-4/h3H,1-2H3 |
InChI Key: | PSBGFLWVQDGETK-UHFFFAOYSA-N |
Boiling Point: | 270.3 °C at 760 mmHg |
Density: | 1.342 g/cm3 |
Appearance: | Solid |
MDL: | MFCD08543468 |
LogP: | 2.78320 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2021079000-A1 | Process for preparation of grapiprant | 20190812 |
WO-2020014445-A1 | Ep4 inhibitors and synthesis thereof | 20180711 |
CN-113301896-A | EP4 inhibitors and synthesis thereof | 20180711 |
EP-3820469-A1 | Ep4 inhibitors and synthesis thereof | 20180711 |
US-2021300921-A1 | Ep4 inhibitors and synthesis thereof | 20180711 |
Complexity: | 183 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.0196052 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.0196052 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS