4-Chloro-2,6-dibromoaniline - CAS 874-17-9
Catalog: |
BB038431 |
Product Name: |
4-Chloro-2,6-dibromoaniline |
CAS: |
874-17-9 |
Synonyms: |
2,6-dibromo-4-chloroaniline |
IUPAC Name: | 2,6-dibromo-4-chloroaniline |
Description: | 4-Chloro-2,6-dibromoaniline (CAS# 874-17-9) is a useful research chemical. |
Molecular Weight: | 285.36 |
Molecular Formula: | C6H4Br2ClN |
Canonical SMILES: | C1=C(C=C(C(=C1Br)N)Br)Cl |
InChI: | InChI=1S/C6H4Br2ClN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2 |
InChI Key: | XEYLQXUJSOJWJV-UHFFFAOYSA-N |
Boiling Point: | 297.4 °C at 760 mmHg |
Melting Point: | 93-95 °C |
Purity: | 98 % |
Density: | 2.097 g/cm3 |
MDL: | MFCD00051750 |
LogP: | 4.02840 |
GHS Hazard Statement: | H302 (11.36%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020170178-A1 | A process for the synthesis anthranilic diamide compounds and intermediates thereof | 20190222 |
WO-2020045535-A1 | Active light sensitive or radiation sensitive resin composition, active light sensitive or radiation sensitive film, pattern forming method, photomask, method for producing electronic device, and compound | 20180901 |
TW-202014405-A | Photosensitive or radioactive resin composition, photosensitive or radioactive film, pattern forming method, photomask, electronic device manufacturing method and compound | 20180901 |
WO-2020010140-A1 | Nlrp modulators | 20180703 |
EP-3817815-A1 | Nlrp modulators | 20180703 |
PMID | Publication Date | Title | Journal |
22719659 | 20120601 | 2,6-Dibromo-4-chloro-aniline | Acta crystallographica. Section E, Structure reports online |
Complexity: | 110 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 284.83785 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 282.83990 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS