4-Bromothiophene-2-carbonitrile - CAS 18791-99-6
Catalog: |
BB014472 |
Product Name: |
4-Bromothiophene-2-carbonitrile |
CAS: |
18791-99-6 |
Synonyms: |
4-bromo-2-thiophenecarbonitrile; 4-bromothiophene-2-carbonitrile |
IUPAC Name: | 4-bromothiophene-2-carbonitrile |
Description: | 4-Bromothiophene-2-carbonitrile (CAS# 18791-99-6) is a useful research chemical. |
Molecular Weight: | 188.05 |
Molecular Formula: | C5H2BrNS |
Canonical SMILES: | C1=C(SC=C1Br)C#N |
InChI: | InChI=1S/C5H2BrNS/c6-4-1-5(2-7)8-3-4/h1,3H |
InChI Key: | DJYVXBJLHPKUKS-UHFFFAOYSA-N |
Density: | 1.82 g/cm3 |
MDL: | MFCD00114951 |
LogP: | 2.38228 |
GHS Hazard Statement: | H302+H332 (90.48%): Harmful if swallowed or if inhaled [Warning Acute toxicity, oral; acute toxicity, inhalation] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021123237-A1 | 2-amino-n-(amino-oxo-aryl-lambda6-sulfanylidene)acetamide compounds and their therapeutic use | 20191219 |
US-2020339555-A1 | Therapeutic compounds and methods of use thereof | 20190425 |
WO-2019168874-A1 | Difluoromethoxylation and trifluoromethoxylation compositions and methods for synthesizing same | 20180227 |
US-2021032181-A1 | Difluoromethoxylation and trifluoromethoxylation compositions and methods for synthesizing same | 20180227 |
WO-2019131582-A1 | Nitrogen-containing six-membered ring compound | 20171225 |
Complexity: | 128 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.90913 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.90913 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 52 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS