4-Bromoquinazoline - CAS 354574-59-7
Catalog: |
BB022646 |
Product Name: |
4-Bromoquinazoline |
CAS: |
354574-59-7 |
Synonyms: |
4-bromoquinazoline; 4-bromoquinazoline |
IUPAC Name: | 4-bromoquinazoline |
Description: | 4-Bromoquinazoline (CAS# 354574-59-7) is a useful research chemical. |
Molecular Weight: | 209.04 |
Molecular Formula: | C8H5BrN2 |
Canonical SMILES: | C1=CC=C2C(=C1)C(=NC=N2)Br |
InChI: | InChI=1S/C8H5BrN2/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H |
InChI Key: | WJYKTNSYMVJDBR-UHFFFAOYSA-N |
Boiling Point: | 304 °C |
Density: | 1.656 g/cm3 |
MDL: | MFCD10697879 |
LogP: | 2.39230 |
Publication Number | Title | Priority Date |
CN-112979712-A | Transition metal complexes, polymers, mixtures, compositions and organic electronic devices | 20191216 |
WO-2021120741-A1 | Metal complex and application thereof | 20191216 |
KR-20170002208-A | Hetero-cyclic compound and organic light emitting device using the same | 20150629 |
KR-20150067140-A | Alkynyl heteroaromatic ring compound and application thereof | 20120917 |
CN-103664898-A | Organometallic compound and organic light-emitting device including the same | 20120907 |
Complexity: | 140 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.96361 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.96361 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS