4-Bromopyridine-3-carbonitrile - CAS 154237-70-4
Catalog: |
BB010993 |
Product Name: |
4-Bromopyridine-3-carbonitrile |
CAS: |
154237-70-4 |
Synonyms: |
4-bromopyridine-3-carbonitrile |
IUPAC Name: | 4-bromopyridine-3-carbonitrile |
Description: | 4-Bromopyridine-3-carbonitrile (CAS# 154237-70-4) is a useful research chemical. |
Molecular Weight: | 183.01 |
Molecular Formula: | C6H3BrN2 |
Canonical SMILES: | C1=CN=CC(=C1Br)C#N |
InChI: | InChI=1S/C6H3BrN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H |
InChI Key: | DMQBJRMKGVMOHX-UHFFFAOYSA-N |
Boiling Point: | 292.2 ℃ at 760 mmHg |
Purity: | 95 % |
Density: | 1.72 g/cm3 |
Appearance: | Solid |
MDL: | MFCD08686971 |
LogP: | 1.71578 |
GHS Hazard Statement: | H301 (86.36%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-3644385-A1 | Condensed cyclic compound, composition including the same and organic light-emitting device including the same | 20181025 |
US-2020131150-A1 | Condensed cyclic compound, composition including the same and organic light-emitting device including the same | 20181025 |
WO-2020035052-A1 | Pyrazine compounds and uses thereof | 20180817 |
CN-112055709-A | Pyrazine compounds and uses thereof | 20180817 |
TW-202023559-A | Pyrazine compounds and uses thereof | 20180817 |
Complexity: | 137 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 181.94796 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 181.94796 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 36.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS