4-Bromo-6-azaindole - CAS 69872-17-9
Catalog: |
BB033998 |
Product Name: |
4-Bromo-6-azaindole |
CAS: |
69872-17-9 |
Synonyms: |
4-bromo-1H-pyrrolo[2,3-c]pyridine; 4-bromo-1H-pyrrolo[2,3-c]pyridine |
IUPAC Name: | 4-bromo-1H-pyrrolo[2,3-c]pyridine |
Description: | 4-Bromo-6-azaindole (CAS# 69872-17-9) is a useful research chemical. |
Molecular Weight: | 197.03 |
Molecular Formula: | C7H5BrN2 |
Canonical SMILES: | C1=CNC2=CN=CC(=C21)Br |
InChI: | InChI=1S/C7H5BrN2/c8-6-3-9-4-7-5(6)1-2-10-7/h1-4,10H |
InChI Key: | NZUWATDXQMWXMY-UHFFFAOYSA-N |
Boiling Point: | 337.619 °C at 760 mmHg |
Density: | 1.771 g/cm3 |
Appearance: | Solid |
MDL: | MFCD11847768 |
LogP: | 2.32540 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021062316-A1 | Azaindole carboxamide compounds for the treatment of mycobacterial infections | 20190926 |
WO-2020244613-A1 | 2, 4, 6-tri-substituted pyrimidine compound as atr kinase inhibitor | 20190606 |
WO-2020116662-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
TW-202039512-A | Cycloalkane-1,3-diamine compounds | 20181206 |
CN-113164481-A | Cycloalkane-1, 3-diamine derivatives | 20181206 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.96361 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.96361 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Azaindoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS