4-Bromo-5-chloro-2-fluorotoluene - CAS 201849-17-4
Catalog: |
BB015698 |
Product Name: |
4-Bromo-5-chloro-2-fluorotoluene |
CAS: |
201849-17-4 |
Synonyms: |
1-bromo-2-chloro-5-fluoro-4-methylbenzene; 1-bromo-2-chloro-5-fluoro-4-methylbenzene |
IUPAC Name: | 1-bromo-2-chloro-5-fluoro-4-methylbenzene |
Description: | 4-Bromo-5-chloro-2-fluorotoluene (CAS# 201849-17-4) is a useful research chemical. |
Molecular Weight: | 223.47 |
Molecular Formula: | C7H5BrClF |
Canonical SMILES: | CC1=CC(=C(C=C1F)Br)Cl |
InChI: | InChI=1S/C7H5BrClF/c1-4-2-6(9)5(8)3-7(4)10/h2-3H,1H3 |
InChI Key: | KKCFZSZRHRVSRA-UHFFFAOYSA-N |
Boiling Point: | 221.8 °C at 760 mmHg |
Density: | 1.618 g/cm3 |
LogP: | 3.55000 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110582502-A | Thieno-indeno-monomers and polymers | 20161206 |
EP-3551635-A2 | Thieno-indeno-monomers and polymers | 20161206 |
JP-2020501004-A | Thieno-indeno monomers and polymers | 20161206 |
KR-20190123719-A | Thieno-indeno-monomers and polymers | 20161206 |
US-2019375760-A1 | Thieno-indeno-monomers and polymers | 20161206 |
Complexity: | 120 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 221.92472 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 221.92472 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS