4-Bromo-5-chloro-2-fluorobenzenesulfonyl Chloride - CAS 1208075-41-5
Catalog: |
BB004981 |
Product Name: |
4-Bromo-5-chloro-2-fluorobenzenesulfonyl Chloride |
CAS: |
1208075-41-5 |
Synonyms: |
4-bromo-5-chloro-2-fluorobenzenesulfonyl chloride; 4-bromo-5-chloro-2-fluorobenzenesulfonyl chloride |
IUPAC Name: | 4-bromo-5-chloro-2-fluorobenzenesulfonyl chloride |
Description: | 4-Bromo-5-chloro-2-fluorobenzenesulfonyl Chloride (CAS# 1208075-41-5) is a useful research chemical. |
Molecular Weight: | 307.95 |
Molecular Formula: | C6H2BrCl2FO2S |
Canonical SMILES: | C1=C(C(=CC(=C1Br)Cl)S(=O)(=O)Cl)F |
InChI: | InChI=1S/C6H2BrCl2FO2S/c7-3-1-5(10)6(2-4(3)8)13(9,11)12/h1-2H |
InChI Key: | VNPRKBFETGIANP-UHFFFAOYSA-N |
LogP: | 4.24990 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112759559-A | Sulfonamide compounds as sodium channel blockers and uses thereof | 20191106 |
AU-2017371674-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
BR-112019011121-A2 | benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
EP-3551626-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
JP-2019536810-A | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
Complexity: | 279 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 305.83200 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 305.83200 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS