4-Bromo-5-chloro-1H-indole - CAS 1191028-48-4
Catalog: |
BB004408 |
Product Name: |
4-Bromo-5-chloro-1H-indole |
CAS: |
1191028-48-4 |
Synonyms: |
4-bromo-5-chloro-1H-indole; 4-bromo-5-chloro-1H-indole |
IUPAC Name: | 4-bromo-5-chloro-1H-indole |
Description: | 4-Bromo-5-chloro-1H-indole (CAS# 1191028-48-4 ) is a useful research chemical. |
Molecular Weight: | 230.49 |
Molecular Formula: | C8H5BrClN |
Canonical SMILES: | C1=CC(=C(C2=C1NC=C2)Br)Cl |
InChI: | InChI=1S/C8H5BrClN/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-4,11H |
InChI Key: | YCQQCNILVIDAPA-UHFFFAOYSA-N |
LogP: | 3.58380 |
Publication Number | Title | Priority Date |
KR-101879905-B1 | Organic light-emitting compound and organic electroluminescent device using the same | 20140813 |
KR-20140107164-A | Organic light-emitting compound and organic electroluminescent device using the same | 20140813 |
JP-2015502953-A | Organic light emitting compound and organic electroluminescent device using the same | 20111207 |
JP-5922792-B2 | Organic light emitting compound and organic electroluminescent device using the same | 20111207 |
KR-101488565-B1 | Organic light-emitting compound and organic electroluminescent device using the same | 20111207 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 228.92939 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 228.92939 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 15.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS