4-Bromo-3-methylbenzenesulfonyl chloride - CAS 72256-93-0
Catalog: |
BB034587 |
Product Name: |
4-Bromo-3-methylbenzenesulfonyl chloride |
CAS: |
72256-93-0 |
Synonyms: |
4-bromo-3-methylbenzenesulfonyl chloride |
IUPAC Name: | 4-bromo-3-methylbenzenesulfonyl chloride |
Description: | 4-Bromo-3-methylbenzenesulfonyl chloride (CAS# 72256-93-0) is a useful research chemical. |
Molecular Weight: | 269.54 |
Molecular Formula: | C7H6BrClO2S |
Canonical SMILES: | CC1=C(C=CC(=C1)S(=O)(=O)Cl)Br |
InChI: | InChI=1S/C7H6BrClO2S/c1-5-4-6(12(9,10)11)2-3-7(5)8/h2-4H,1H3 |
InChI Key: | JRNDXUKMWFVEIC-UHFFFAOYSA-N |
Boiling Point: | 311.2 °C at 760 mmHg |
Density: | 1.7 g/cm3 |
Appearance: | Solid |
MDL: | MFCD03094696 |
LogP: | 3.76580 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-109608369-B | Sulfonyl ester group anthraquinone derivative and preparation method and application thereof | 20181224 |
WO-2019149738-A1 | Protein kinase mkk4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
AU-2019216264-A1 | Protein kinase MKK4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
CN-111788195-A | Protein kinase MKK4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
EP-3746437-A1 | Protein kinase mkk4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
Complexity: | 247 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 267.89604 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 267.89604 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS