4-Bromo-3-fluorobenzenethiol - CAS 942473-86-1
Catalog: |
BB041251 |
Product Name: |
4-Bromo-3-fluorobenzenethiol |
CAS: |
942473-86-1 |
Synonyms: |
4-bromo-3-fluorobenzenethiol; 4-bromo-3-fluorobenzenethiol |
IUPAC Name: | 4-bromo-3-fluorobenzenethiol |
Description: | 4-Bromo-3-fluorobenzenethiol (CAS# 942473-86-1) is a useful research chemical compound. |
Molecular Weight: | 207.06 |
Molecular Formula: | C6H4BrFS |
Canonical SMILES: | C1=CC(=C(C=C1S)F)Br |
InChI: | InChI=1S/C6H4BrFS/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
InChI Key: | QWSUMJXRROQYPN-UHFFFAOYSA-N |
MDL: | MFCD09475476 |
LogP: | 2.87690 |
Publication Number | Title | Priority Date |
WO-2020212581-A1 | N-acyl-{4-[(4-aryl-phenyl)sulfonylmethyl]piperidine} compounds and their therapeutic use | 20190418 |
WO-2020035560-A1 | 1-methyl-4-[(4-phenylphenyl)sulfonylmethyl]cyclohexyanol and 1-methyl-4-[[4-(2-pyridyl)phenyl]sulfonylmethyl]cyclohexanol compounds and their therapeutic use | 20180815 |
CN-112805270-A | 1-methyl-4- [ (4-phenylphenyl) sulfonylmethyl ] cyclohexanol and 1-methyl-4- [ [4- (2-pyridinyl) phenyl ] sulfonylmethyl ] cyclohexanol compounds and therapeutic uses thereof | 20180815 |
EP-3837244-A1 | 1-methyl-4-[(4-phenylphenyl)sulfonylmethyl]cyclohexyanol and 1-methyl-4-[[4-(2-pyridyl)phenyl]sulfonylmethyl]cyclohexanol compounds and their therapeutic use | 20180815 |
KR-20210044802-A | 1-methyl-4-[(4-phenylphenyl)sulfonylmethyl]cyclohexyanol and 1-methyl-4-[[4-(2-pyridyl)phenyl]sulfonylmethyl]cyclohexanol compound and its Therapeutic use | 20180815 |
Complexity: | 99.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.92011 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.92011 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS