4-Bromo-3-fluoro-2-methylpyridine - CAS 1211583-78-6
Catalog: |
BB005088 |
Product Name: |
4-Bromo-3-fluoro-2-methylpyridine |
CAS: |
1211583-78-6 |
Synonyms: |
4-bromo-3-fluoro-2-methylpyridine; 4-bromo-3-fluoro-2-methylpyridine |
IUPAC Name: | 4-bromo-3-fluoro-2-methylpyridine |
Description: | 4-Bromo-3-fluoro-2-methylpyridine (CAS# 1211583-78-6) is a useful research chemical. |
Molecular Weight: | 190.01 |
Molecular Formula: | C6H5BrFN |
Canonical SMILES: | CC1=NC=CC(=C1F)Br |
InChI: | InChI=1S/C6H5BrFN/c1-4-6(8)5(7)2-3-9-4/h2-3H,1H3 |
InChI Key: | MOCRCEBISJMOGG-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
GHS Hazard Statement: | H227 (100%): Combustible liquid [Warning Flammable liquids] |
Precautionary Statement: | P210, P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P370+P378, P403+P233, P403+P235, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020360353-A1 | Macrocyclic azolopyridine derivatives as eed and prc2 modulators | 20190315 |
WO-2020190754-A1 | Macrocyclic azolopyridine derivatives as eed and prc2 modulators | 20190315 |
TW-202102495-A | Macrocyclic azolopyridine derivatives as eed and prc2 modulators | 20190315 |
US-10973805-B2 | Macrocyclic azolopyridine derivatives as EED and PRC2 modulators | 20190315 |
WO-2020117961-A1 | Morpholinyl, piperazinyl, oxazepanyl and diazepanyl o-glycoprotein-2-acetamido-2-deoxy-3-d-glucopyranosidase inhibitors | 20181205 |
Complexity: | 99.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 188.95894 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 188.95894 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS