4-Bromo-3-ethylpyrazole - CAS 15802-79-6
Catalog: |
BB011385 |
Product Name: |
4-Bromo-3-ethylpyrazole |
CAS: |
15802-79-6 |
Synonyms: |
4-bromo-5-ethyl-1H-pyrazole; 4-bromo-5-ethyl-1H-pyrazole |
IUPAC Name: | 4-bromo-5-ethyl-1H-pyrazole |
Description: | 4-Bromo-3-ethylpyrazole (CAS# 15802-79-6) is a useful research chemical. |
Molecular Weight: | 175.03 |
Molecular Formula: | C5H7BrN2 |
Canonical SMILES: | CCC1=C(C=NN1)Br |
InChI: | InChI=1S/C5H7BrN2/c1-2-5-4(6)3-7-8-5/h3H,2H2,1H3,(H,7,8) |
InChI Key: | QJIWUPJCGOTRMI-UHFFFAOYSA-N |
MDL: | MFCD16620172 |
LogP: | 1.73460 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020131627-A1 | Substituted pyrazolo[1,5-a]pyridine compounds as inhibitors of fgfr tyrosine kinases | 20181219 |
CN-113490666-A | Substituted pyrazolo [1,5-A ] pyridine compounds as inhibitors of FGFR tyrosine kinases | 20181219 |
EP-3898626-A1 | Substituted pyrazolo[1,5-a]pyridine compounds as inhibitors of fgfr tyrosine kinases | 20181219 |
CN-113272297-A | Pyrazole derivatives as H4 antagonist compounds | 20181019 |
KR-20210079318-A | H4 antagonist compounds | 20181019 |
Complexity: | 76.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 173.97926 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 173.97926 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 28.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS