4-Bromo-3-chlorobenzonitrile - CAS 57418-97-0
Catalog: |
BB029700 |
Product Name: |
4-Bromo-3-chlorobenzonitrile |
CAS: |
57418-97-0 |
Synonyms: |
4-bromo-3-chlorobenzonitrile; 4-bromo-3-chlorobenzonitrile |
IUPAC Name: | 4-bromo-3-chlorobenzonitrile |
Description: | 4-Bromo-3-chlorobenzonitrile (CAS# 57418-97-0) is a useful research chemical. |
Molecular Weight: | 216.46 |
Molecular Formula: | C7H3BrClN |
Canonical SMILES: | C1=CC(=C(C=C1C#N)Cl)Br |
InChI: | InChI=1S/C7H3BrClN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
InChI Key: | YWTKUWXYQQZSIL-UHFFFAOYSA-N |
Boiling Point: | 261 °C |
Density: | 1.74 g/cm3 |
MDL: | MFCD09834777 |
LogP: | 2.97418 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020212581-A1 | N-acyl-{4-[(4-aryl-phenyl)sulfonylmethyl]piperidine} compounds and their therapeutic use | 20190418 |
WO-2020035560-A1 | 1-methyl-4-[(4-phenylphenyl)sulfonylmethyl]cyclohexyanol and 1-methyl-4-[[4-(2-pyridyl)phenyl]sulfonylmethyl]cyclohexanol compounds and their therapeutic use | 20180815 |
EP-3837244-A1 | 1-methyl-4-[(4-phenylphenyl)sulfonylmethyl]cyclohexyanol and 1-methyl-4-[[4-(2-pyridyl)phenyl]sulfonylmethyl]cyclohexanol compounds and their therapeutic use | 20180815 |
KR-20210044802-A | 1-methyl-4-[(4-phenylphenyl)sulfonylmethyl]cyclohexyanol and 1-methyl-4-[[4-(2-pyridyl)phenyl]sulfonylmethyl]cyclohexanol compound and its Therapeutic use | 20180815 |
WO-2020030924-A1 | Thiazoleureas as anticancer agents | 20180810 |
Complexity: | 162 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 214.91374 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 214.91374 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 23.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS