4-Bromo-3-chloro-2-methylpyridine - CAS 1188140-52-4
Catalog: |
BB004302 |
Product Name: |
4-Bromo-3-chloro-2-methylpyridine |
CAS: |
1188140-52-4 |
Synonyms: |
4-bromo-3-chloro-2-methylpyridine; 4-bromo-3-chloro-2-methylpyridine |
IUPAC Name: | 4-bromo-3-chloro-2-methylpyridine |
Description: | 4-Bromo-3-chloro-2-methylpyridine (CAS# 1188140-52-4 ) is a useful research chemical. |
Molecular Weight: | 206.47 |
Molecular Formula: | C6H5BrClN |
Canonical SMILES: | CC1=NC=CC(=C1Cl)Br |
InChI: | InChI=1S/C6H5BrClN/c1-4-6(8)5(7)2-3-9-4/h2-3H,1H3 |
InChI Key: | NUGJZYYBZIRDHI-UHFFFAOYSA-N |
LogP: | 2.80590 |
Publication Number | Title | Priority Date |
CN-109415341-A | α derived from benzotriazole as TGF-β R1 inhibitor, β unsaturated acyl amine compound | 20160613 |
CN-106715430-B | Inhibit transient receptor potential A1 ion channel | 20140919 |
CN-105143207-B | As the substituted pyridine of PDE4 inhibitor and the pyrazine compound of substitution | 20130314 |
CN-108299400-A | Substituted pyridine as PDE4 inhibitor and substituted pyrazine compound | 20130314 |
CN-104203952-B | Imidazo pyrrolidone-2 compounds | 20120126 |
Complexity: | 99.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.92939 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.92939 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS