4-Bromo-2-iodobenzotrifluoride - CAS 1256945-00-2
Catalog: |
BB006231 |
Product Name: |
4-Bromo-2-iodobenzotrifluoride |
CAS: |
1256945-00-2 |
Synonyms: |
4-bromo-2-iodo-1-(trifluoromethyl)benzene; 4-bromo-2-iodo-1-(trifluoromethyl)benzene |
IUPAC Name: | 4-bromo-2-iodo-1-(trifluoromethyl)benzene |
Description: | 4-Bromo-2-iodobenzotrifluoride (CAS# 1256945-00-2) is a useful research chemical. |
Molecular Weight: | 350.90 |
Molecular Formula: | C7H3BrF3I |
Canonical SMILES: | C1=CC(=C(C=C1Br)I)C(F)(F)F |
InChI: | InChI=1S/C7H3BrF3I/c8-4-1-2-5(6(12)3-4)7(9,10)11/h1-3H |
InChI Key: | PGFPLTAEOHMUKY-UHFFFAOYSA-N |
Storage: | Keep in dark place, Sealed in dry, 2-8 °C |
MDL: | MFCD21603817 |
LogP: | 4.07250 |
Publication Number | Title | Priority Date |
JP-2018168138-A | Benzobis (thiadiazole) derivative containing oxygen-containing hydrocarbon group, ink containing the same, and organic electronic device using the same | 20170329 |
NZ-751511-A | Tetrahydropyridine derivatives and their use as antibacterial agents | 20160928 |
JP-2017079319-A | Organic transistor using benzobis (thiadiazole) derivative and organic electronic device using the same | 20150319 |
EP-3048107-A1 | Benzobis (thiadiazole) derivative, ink containing same, and organic electronic device using same | 20130920 |
JP-6427101-B2 | Benzobis (thiadiazole) derivative, ink containing the same, and organic electronic device using the same | 20130920 |
Complexity: | 159 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 349.84149 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 349.84149 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS