4-Bromo-2-hydroxypyridine - CAS 36953-37-4
Catalog: |
BB023149 |
Product Name: |
4-Bromo-2-hydroxypyridine |
CAS: |
36953-37-4 |
Synonyms: |
4-bromo-1H-pyridin-2-one; 4-bromo-1H-pyridin-2-one |
Description: | 4-Bromo-2-hydroxypyridine (CAS# 36953-37-4) is used as a reagent to synthesize trans-3,4'-bispyridinylethylenes, compounds that act as inhibitors of protein kinase B that are used to treat cancer. |
Molecular Weight: | 174.00 |
Molecular Formula: | C5H4BrNO |
Canonical SMILES: | C1=CNC(=O)C=C1Br |
InChI: | InChI=1S/C5H4BrNO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8) |
InChI Key: | SSLMGOKTIUIZLY-UHFFFAOYSA-N |
Boiling Point: | 305.9 ℃ at 760 mmHg |
Density: | 1.776 g/cm3 |
MDL: | MFCD11226860 |
LogP: | 1.54970 |
GHS Hazard Statement: | H302 (30%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021160127-A1 | Heterocyclic glp-1 agonists | 20200213 |
WO-2021155321-A2 | Compounds and uses thereof | 20200129 |
WO-2021130259-A1 | Dihydrocyclopenta-isoquinoline-sulfonamide derivatives compounds | 20191223 |
WO-2021076890-A1 | INHIBITING HUMAN INTEGRIN α4β7 | 20191016 |
WO-2021076902-A1 | INHIBITING HUMAN INTEGRIN α 4 β 7 | 20191016 |
Complexity: | 171 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.94763 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.94763 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 29.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS