4-Bromo-2-fluoro-5-methylpyridine - CAS 1227577-02-7
Catalog: |
BB005491 |
Product Name: |
4-Bromo-2-fluoro-5-methylpyridine |
CAS: |
1227577-02-7 |
Synonyms: |
4-bromo-2-fluoro-5-methylpyridine; 4-bromo-2-fluoro-5-methylpyridine |
IUPAC Name: | 4-bromo-2-fluoro-5-methylpyridine |
Description: | 4-Bromo-2-fluoro-5-methylpyridine has properties and potential for diabetes treatment. |
Molecular Weight: | 190.01 |
Molecular Formula: | C6H5BrFN |
Canonical SMILES: | CC1=CN=C(C=C1Br)F |
InChI: | InChI=1S/C6H5BrFN/c1-4-3-9-6(8)2-5(4)7/h2-3H,1H3 |
InChI Key: | MGEKKKTXWYECMW-UHFFFAOYSA-N |
LogP: | 2.29160 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020216190-A1 | Quinazoline compound and pharmaceutical application thereof | 20190422 |
TW-202104227-A | Quinazoline compounds and their applications in medicine | 20190422 |
EP-3472161-A1 | Triazolopyridine compounds and uses thereof | 20160620 |
EP-3472161-B1 | Triazolopyridine compounds and uses thereof | 20160620 |
JP-2019522049-A | Triazolopyridine compounds and uses thereof | 20160620 |
Complexity: | 99.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 188.95894 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 188.95894 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS