4-Bromo-2-chloro-3-iodopyridine - CAS 916203-52-6
Catalog: |
BB040282 |
Product Name: |
4-Bromo-2-chloro-3-iodopyridine |
CAS: |
916203-52-6 |
Synonyms: |
4-bromo-2-chloro-3-iodopyridine |
IUPAC Name: | 4-bromo-2-chloro-3-iodopyridine |
Description: | 4-Bromo-2-chloro-3-iodopyridine (CAS# 916203-52-6) is a useful research chemical. |
Molecular Weight: | 318.34 |
Molecular Formula: | C5H2BrClIN |
Canonical SMILES: | C1=CN=C(C(=C1Br)I)Cl |
InChI: | InChI=1S/C5H2BrClIN/c6-3-1-2-9-5(7)4(3)8/h1-2H |
InChI Key: | ALKCOVKKTNNOGX-UHFFFAOYSA-N |
Boiling Point: | 317.8 °C at 760 mmHg |
Density: | 2.395 g/cm3 |
MDL: | MFCD08060939 |
LogP: | 3.10210 |
GHS Hazard Statement: | H301 (88.64%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-3114119-A1 | Mcl-1 modulating compounds for cancer treatment | 20140304 |
WO-2015132727-A1 | Mcl-1 modulating compounds for cancer treatment | 20140304 |
PMID | Publication Date | Title | Journal |
17064040 | 20061027 | Unique tandem Heck-lactamization naphthyridinone ring formation between acrylanilides and halogenated pyridines | The Journal of organic chemistry |
Complexity: | 103 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 316.81039 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 316.81039 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS