4-bromo-2-(bromomethyl)-1-iodobenzene - CAS 495414-06-7
Catalog: |
BB026721 |
Product Name: |
4-bromo-2-(bromomethyl)-1-iodobenzene |
CAS: |
495414-06-7 |
Synonyms: |
4-bromo-2-(bromomethyl)-1-iodobenzene; 4-bromo-2-(bromomethyl)-1-iodobenzene |
IUPAC Name: | 4-bromo-2-(bromomethyl)-1-iodobenzene |
Description: | 4-bromo-2-(bromomethyl)-1-iodobenzene (CAS# 495414-06-7) is a useful research chemical compound. |
Molecular Weight: | 375.829 |
Molecular Formula: | C7H5Br2I |
Canonical SMILES: | C1=CC(=C(C=C1Br)CBr)I |
InChI: | InChI=1S/C7H5Br2I/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
InChI Key: | AHETZDTVQBIWSL-UHFFFAOYSA-N |
MDL: | MFCD12025360 |
LogP: | 3.94860 |
Publication Number | Title | Priority Date |
CA-3056970-A1 | 2-methyl-quinazolines | 20170321 |
EP-3601267-A1 | 2-methyl-quinazolines | 20170321 |
WO-2018172250-A1 | 2-methyl-quinazolines | 20170321 |
US-2013059996-A1 | Boron-Containing PI-Electron Materials Incorporating Formally Aromatic and Neutral Borepin Rings | 20100409 |
WO-2011127383-A2 | Boron-containing pi-electron materials incorporating formally aromatic and neutral borepin rings | 20100409 |
Complexity: | 108 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 375.77822 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 373.78027 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS