4-Bromo-2,6-dimethylphenyl isocyanate - CAS 77159-76-3
Catalog: |
BB035843 |
Product Name: |
4-Bromo-2,6-dimethylphenyl isocyanate |
CAS: |
77159-76-3 |
Synonyms: |
5-bromo-2-isocyanato-1,3-dimethylbenzene |
IUPAC Name: | 5-bromo-2-isocyanato-1,3-dimethylbenzene |
Description: | 4-Bromo-2,6-dimethylphenyl isocyanate (CAS# 77159-76-3) is an organic synthesis building block and a pharmaceutical intermediate. |
Molecular Weight: | 226.07 |
Molecular Formula: | C9H8BrNO |
Canonical SMILES: | CC1=CC(=CC(=C1N=C=O)C)Br |
InChI: | InChI=1S/C9H8BrNO/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3 |
InChI Key: | XGBDVSJAHTYSBK-UHFFFAOYSA-N |
Boiling Point: | 280.5 ℃ at 760 mmHg |
Density: | 1.39 g/cm3 |
Appearance: | Solid |
MDL: | MFCD00037040 |
LogP: | 3.03320 |
GHS Hazard Statement: | H302 (90.48%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021004842-A1 | Polymerizable compositions for preparing polyisocyanurate-based plastics having extended worklife | 20190708 |
TW-202003448-A | Adducts of amine catalysts for producing isocyanurate polymers | 20180413 |
WO-2019197638-A1 | Adducts of amine catalysts for producing isocyanurate polymers | 20180413 |
CN-112020525-A | Adducts of amine catalysts for making isocyanurate polymers | 20180413 |
EP-3774961-A1 | Adducts of amine catalysts for producing isocyanurate polymers | 20180413 |
Complexity: | 189 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.97893 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.97893 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 29.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS