4-Bromo-2,5-difluorobenzaldehyde - CAS 357405-75-5
Catalog: |
BB022749 |
Product Name: |
4-Bromo-2,5-difluorobenzaldehyde |
CAS: |
357405-75-5 |
Synonyms: |
4-bromo-2,5-difluorobenzaldehyde; 4-bromo-2,5-difluorobenzaldehyde |
IUPAC Name: | 4-bromo-2,5-difluorobenzaldehyde |
Description: | 4-Bromo-2,5-difluorobenzaldehyde (CAS# 357405-75-5) is a useful research chemical. |
Molecular Weight: | 221.00 |
Molecular Formula: | C7H3BrF2O |
Canonical SMILES: | C1=C(C(=CC(=C1F)Br)F)C=O |
InChI: | InChI=1S/C7H3BrF2O/c8-5-2-6(9)4(3-11)1-7(5)10/h1-3H |
InChI Key: | PDRHYPUKWIHZMP-UHFFFAOYSA-N |
MDL: | MFCD11847047 |
LogP: | 2.53980 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112812781-A | Bipiperazine benzoxazole-based liquid crystal compound and preparation method thereof | 20210121 |
WO-2021055295-A1 | Brd9 bifunctional degraders and their methods of use | 20190916 |
AU-2018332887-A1 | Bisamide sarcomere activating compounds and uses thereof | 20170913 |
CA-3075669-A1 | Bisamide sarcomere activating compounds and uses thereof | 20170913 |
KR-20200054237-A | Bisamide muscle fibrillar node activating compound and use thereof | 20170913 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 219.93353 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 219.93353 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS