4-(Benzylthio)pyridine - CAS 51290-78-9
Catalog: |
BB027396 |
Product Name: |
4-(Benzylthio)pyridine |
CAS: |
51290-78-9 |
Synonyms: |
4-(phenylmethylthio)pyridine; 4-benzylsulfanylpyridine |
IUPAC Name: | 4-benzylsulfanylpyridine |
Description: | 4-(Benzylthio)pyridine (CAS# 51290-78-9 ) is a useful research chemical. |
Molecular Weight: | 201.29 |
Molecular Formula: | C12H11NS |
Canonical SMILES: | C1=CC=C(C=C1)CSC2=CC=NC=C2 |
InChI: | InChI=1S/C12H11NS/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-9H,10H2 |
InChI Key: | WHHDQCXCEKZXHK-UHFFFAOYSA-N |
Boiling Point: | 337.4 ℃ at 760 mmHg |
Density: | 1.15 g/cm3 |
LogP: | 3.37390 |
Publication Number | Title | Priority Date |
CN-109641873-A | N- (pyridine -2- base) pyridine-sulfamide derivative and its purposes for disease treatment | 20160829 |
TW-201811766-A | N-(pyridin-2-yl)pyridine-sulfonamide derivatives and their use for the treatment of diseases | 20160829 |
EP-2426125-B1 | 1,4 disubstituted 3 cyano pyridone derivatives and their use as positive allosteric modulators of mGluR2 receptors | 20060315 |
JP-3319926-B2 | Fluorine-containing compound, surface modifier, and magnetic disk drive using the same | 19951116 |
JP-H09136952-A | Fluorine-containing compound, surface modifier, and magnetic disk device using the same | 19951116 |
PMID | Publication Date | Title | Journal |
17321746 | 20070415 | Hybrid molecules of estrone: new compounds with potential antibacterial, antifungal, and antiproliferative activities | Bioorganic & medicinal chemistry |
14695841 | 20040101 | Antimycobacterial agents. 1. Thio analogues of purine | Journal of medicinal chemistry |
Complexity: | 148 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.06122053 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.06122053 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 38.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS