4-Benzyl-2-(chloromethyl)morpholine - CAS 40987-25-5
Catalog: |
BB024739 |
Product Name: |
4-Benzyl-2-(chloromethyl)morpholine |
CAS: |
40987-25-5 |
Synonyms: |
2-(chloromethyl)-4-(phenylmethyl)morpholine; 4-benzyl-2-(chloromethyl)morpholine |
IUPAC Name: | 4-benzyl-2-(chloromethyl)morpholine |
Description: | 4-Benzyl-2-(chloromethyl)morpholine (CAS# 40987-25-5) is a useful research chemical. |
Molecular Weight: | 225.71 |
Molecular Formula: | C12H16ClNO |
Canonical SMILES: | C1COC(CN1CC2=CC=CC=C2)CCl |
InChI: | InChI=1S/C12H16ClNO/c13-8-12-10-14(6-7-15-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
InChI Key: | GVWRZZNYCOTWNN-UHFFFAOYSA-N |
Boiling Point: | 120-122 °C / 1 mmHg |
Density: | 1.132 g/cm3 |
Appearance: | Colorless liquid |
MDL: | MFCD02681886 |
LogP: | 2.06410 |
GHS Hazard Statement: | H302 (33.33%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P330, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-109293656-A | Bcl-2 selective depressant and its preparation and use | 20170724 |
CN-109641897-A | Bcl-2 selective depressant and its preparation and use | 20160901 |
WO-2018041248-A1 | Bcl-2 selective inhibitor and preparation and use thereof | 20160901 |
AU-2014369085-A1 | Indazole compounds as 5-HT4 receptor agonists | 20131216 |
AU-2014369085-B2 | Indazole compounds as 5-HT4 receptor agonists | 20131216 |
Complexity: | 183 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 225.0920418 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 225.0920418 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 12.5 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS