4-Aminotetrahydropyran-2-one - CAS 107146-27-0
Catalog: |
BB001984 |
Product Name: |
4-Aminotetrahydropyran-2-one |
CAS: |
107146-27-0 |
Synonyms: |
4-amino-2-oxanone; 4-aminooxan-2-one |
IUPAC Name: | 4-aminooxan-2-one |
Description: | 4-Aminotetrahydropyran-2-one (CAS# 107146-27-0 ) is a useful research chemical. |
Molecular Weight: | 115.13 |
Molecular Formula: | C5H9NO2 |
Canonical SMILES: | C1COC(=O)CC1N |
InChI: | InChI=1S/C5H9NO2/c6-4-1-2-8-5(7)3-4/h4H,1-3,6H2 |
InChI Key: | BERHIXIZFDTNBN-UHFFFAOYSA-N |
LogP: | 0.00000 |
Publication Number | Title | Priority Date |
KR-20150093240-A | Heterocyclic compound | 20121211 |
KR-101794009-B1 | Heterocyclic amides as rock inhibitors | 20100302 |
WO-2011107608-A1 | Heterocyclic amides as rock inhibitors | 20100302 |
TW-I283678-B | Pyrazolo[3,4-b]pyridine compounds, and their use as phosphodiesterase inhibitors | 20020916 |
US-2004006047-A1 | Heterocyclic amides, a process for their preparation, compositions comprising them and their use | 20010929 |
Complexity: | 103 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 115.06332853 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 115.06332853 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 52.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS