4-(Aminomethyl)-1-ethylpiperidine - CAS 21168-71-8
Catalog: |
BB016657 |
Product Name: |
4-(Aminomethyl)-1-ethylpiperidine |
CAS: |
21168-71-8 |
Synonyms: |
(1-ethyl-4-piperidinyl)methanamine; (1-ethylpiperidin-4-yl)methanamine |
IUPAC Name: | (1-ethylpiperidin-4-yl)methanamine |
Description: | 4-(Aminomethyl)-1-ethylpiperidine (CAS# 21168-71-8) is a useful research chemical compound. |
Molecular Weight: | 142.24 |
Molecular Formula: | C8H18N2 |
Canonical SMILES: | CCN1CCC(CC1)CN |
InChI: | InChI=1S/C8H18N2/c1-2-10-5-3-8(7-9)4-6-10/h8H,2-7,9H2,1H3 |
InChI Key: | ZLODGCYXZYPQKQ-UHFFFAOYSA-N |
Boiling Point: | 87 °C |
Density: | 0.89 g/cm3 |
LogP: | 1.31520 |
GHS Hazard Statement: | H227 (100%): Combustible liquid [Warning Flammable liquids] |
Precautionary Statement: | P210, P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P370+P378, P403+P235, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021127278-A1 | Irak degraders and uses thereof | 20191217 |
WO-2021032934-A1 | Enzyme inhibitors | 20190821 |
WO-2020207260-A1 | Cdk inhibitor and application thereof | 20190408 |
WO-2020150385-A1 | Antimicrobial compounds and methods | 20190116 |
WO-2018165112-A1 | Bicyclic compound and use thereof for inhibiting histone methyltransferase | 20170309 |
Complexity: | 85.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 142.146998583 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 142.146998583 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 29.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS