4-Amino-pyridine-3-carboxaldehyde - CAS 42373-30-8
Catalog: |
BB025117 |
Product Name: |
4-Amino-pyridine-3-carboxaldehyde |
CAS: |
42373-30-8 |
Synonyms: |
4-aminopyridine-3-carbaldehyde |
IUPAC Name: | 4-aminopyridine-3-carbaldehyde |
Description: | 4-Aminonicotinaldehyde acts as a reagent used in the preparation of 2,3-disubstituted 1,6-naphthyridines as a potential diurectic agents. |
Molecular Weight: | 122.12 |
Molecular Formula: | C6H6N2O |
Canonical SMILES: | C1=CN=CC(=C1N)C=O |
InChI: | InChI=1S/C6H6N2O/c7-6-1-2-8-3-5(6)4-9/h1-4H,(H2,7,8) |
InChI Key: | GTPZHMGXKZIHKW-UHFFFAOYSA-N |
Boiling Point: | 342.2 °C at 760 mmHg |
Density: | 1.264 g/cm3 |
Appearance: | Powder |
MDL: | MFCD04038972 |
LogP: | 1.05750 |
GHS Hazard Statement: | H302 (85.11%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P272, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112979655-A | Triazolopyridazine derivative, preparation method, pharmaceutical composition and application thereof | 20191216 |
WO-2021121294-A1 | Triazolopyridazine derivative, preparation method therefor, pharmaceutical composition thereof, and use thereof | 20191216 |
WO-2021058592-A1 | Herbicidal compounds | 20190924 |
WO-2020243459-A1 | Thiadiazolyl derivatives as dna polymerase theta inhibitors | 20190531 |
US-2020155538-A1 | Quinoline derivatives | 20181030 |
Complexity: | 105 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 122.048012819 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 122.048012819 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 56 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS