4-Amino-8-chloro-6-methylquinoline - CAS 948293-57-0
Catalog: |
BB041545 |
Product Name: |
4-Amino-8-chloro-6-methylquinoline |
CAS: |
948293-57-0 |
Synonyms: |
8-chloro-6-methylquinolin-4-amine |
IUPAC Name: | 8-chloro-6-methylquinolin-4-amine |
Description: | 4-Amino-8-chloro-6-methylquinoline (CAS# 948293-57-0) is a useful research chemical. |
Molecular Weight: | 192.64 |
Molecular Formula: | C10H9ClN2 |
Canonical SMILES: | CC1=CC2=C(C=CN=C2C(=C1)Cl)N |
InChI: | InChI=1S/C10H9ClN2/c1-6-4-7-9(12)2-3-13-10(7)8(11)5-6/h2-5H,1H3,(H2,12,13) |
InChI Key: | AACXNUWLLIDMPR-UHFFFAOYSA-N |
Boiling Point: | 382 °C at 760 mmHg |
Density: | 1.307 g/cm3 |
LogP: | 3.36000 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]; H318 (100%): Causes serious eye damage [Danger Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
AU-2011351375-A1 | Heterocyclic compounds and their use as glycogen synthase kinase-3 inhibitors | 20101230 |
AU-2011351375-B2 | Heterocyclic compounds and their use as glycogen synthase kinase-3 inhibitors | 20101230 |
CA-2821863-A1 | Heterocyclic compounds and their use as glycogen synthase kinase-3 inhibitors | 20101230 |
CN-103476766-B | Heterocyclic compound and they are as the purposes of glycogen synthase kinase-3 inhibitors | 20101230 |
EP-2658854-A2 | Heterocyclic compounds and their use as glycogen synthase kinase-3 inhibitors | 20101230 |
Complexity: | 186 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 192.045426 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 192.045426 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS