4-Amino-5-chloro-1-methylpyrazole - CAS 406189-04-6
Catalog: |
BB024588 |
Product Name: |
4-Amino-5-chloro-1-methylpyrazole |
CAS: |
406189-04-6 |
Synonyms: |
5-chloro-1-methyl-4-pyrazolamine; 5-chloro-1-methylpyrazol-4-amine |
IUPAC Name: | 5-chloro-1-methylpyrazol-4-amine |
Description: | 4-Amino-5-chloro-1-methylpyrazole (CAS# 406189-04-6 ) is a useful research chemical. |
Molecular Weight: | 131.56 |
Molecular Formula: | C4H6ClN3 |
Canonical SMILES: | CN1C(=C(C=N1)N)Cl |
InChI: | InChI=1S/C4H6ClN3/c1-8-4(5)3(6)2-7-8/h2H,6H2,1H3 |
InChI Key: | HHGWNOSKFDRZHS-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
WO-2021075476-A1 | Heterocyclic compound | 20191018 |
CN-112654605-A | Bridged heterocyclic group substituted pyrimidine compound and preparation method and medical application thereof | 20190809 |
WO-2021027647-A1 | Bridged heterocyclyl-substituted pyrimidine compound, preparation method therefor, and pharmaceutical use thereof | 20190809 |
WO-2019112269-A1 | Pyrrolo(pyrazolo)pyrimidine derivative as lrrk2 inhibitor | 20171205 |
CA-3083583-A1 | Pyrrolo(pyrazolo)pyrimidine derivative as lrrk2 inhibitor | 20171205 |
Complexity: | 87.4 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 131.0250249 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 131.0250249 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS