4-Amino-3-phenylpyridine - CAS 1211524-38-7
Catalog: |
BB005060 |
Product Name: |
4-Amino-3-phenylpyridine |
CAS: |
1211524-38-7 |
Synonyms: |
3-phenyl-4-pyridinamine; 3-phenylpyridin-4-amine |
IUPAC Name: | 3-phenylpyridin-4-amine |
Description: | 4-Amino-3-phenylpyridine (CAS# 1211524-38-7) is a useful research chemical. |
Molecular Weight: | 170.21 |
Molecular Formula: | C11H10N2 |
Canonical SMILES: | C1=CC=C(C=C1)C2=C(C=CN=C2)N |
InChI: | InChI=1S/C11H10N2/c12-11-6-7-13-8-10(11)9-4-2-1-3-5-9/h1-8H,(H2,12,13) |
InChI Key: | GRTBROPARUQBTJ-UHFFFAOYSA-N |
LogP: | 2.26090 |
Publication Number | Title | Priority Date |
EP-3770166-A1 | Organometallic compound and organic light-emitting device including the same | 20190723 |
EP-3770166-B1 | Organometallic compound and organic light-emitting device including the same | 20190723 |
EP-3670520-A1 | Organometallic compound, organic light-emitting device including the organometallic compound, and diagnostic composition including the organometallic compound | 20181219 |
JP-2019112341-A | Aryl triazine compounds and organic electroluminescent devices using the same | 20171222 |
EP-3489249-A1 | Organometallic compound and organic light-emitting device including the same | 20171123 |
Complexity: | 152 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 170.084398327 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 170.084398327 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS