4-Amino-2-(hydroxymethyl)pyridine - CAS 100114-58-7
Catalog: |
BB000089 |
Product Name: |
4-Amino-2-(hydroxymethyl)pyridine |
CAS: |
100114-58-7 |
Synonyms: |
(4-amino-2-pyridinyl)methanol; (4-aminopyridin-2-yl)methanol |
IUPAC Name: | (4-aminopyridin-2-yl)methanol |
Description: | 4-Amino-2-(hydroxymethyl)pyridine (CAS# 100114-58-7) is a useful research chemical. |
Molecular Weight: | 124.14 |
Molecular Formula: | C6H8N2O |
Canonical SMILES: | C1=CN=C(C=C1N)CO |
InChI: | InChI=1S/C6H8N2O/c7-5-1-2-8-6(3-5)4-9/h1-3,9H,4H2,(H2,7,8) |
InChI Key: | ZBKZWFGHOALGNP-UHFFFAOYSA-N |
Boiling Point: | 348.2 °C at 760 mmHg |
Density: | 1.257 g/cm3 |
Appearance: | Solid |
Storage: | Keep in dark place, Inert atmosphere, 2-8 °C |
LogP: | 0.73730 |
Publication Number | Title | Priority Date |
AU-2018360285-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
CA-3081142-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
WO-2019086614-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
CN-111527068-A | Novel aminopyridine carbinol compounds and uses thereof | 20171103 |
EP-3704093-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
Complexity: | 87.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 124.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 124.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 59.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS