4-Amino-2-fluoro-5-iodobenzonitrile - CAS 380241-60-1
Catalog: |
BB023490 |
Product Name: |
4-Amino-2-fluoro-5-iodobenzonitrile |
CAS: |
380241-60-1 |
Synonyms: |
4-amino-2-fluoro-5-iodobenzonitrile; 4-amino-2-fluoro-5-iodobenzonitrile |
IUPAC Name: | 4-amino-2-fluoro-5-iodobenzonitrile |
Description: | 4-Amino-2-fluoro-5-iodobenzonitrile (CAS# 380241-60-1) is a useful research chemical. |
Molecular Weight: | 262.02 |
Molecular Formula: | C7H4FIN2 |
Canonical SMILES: | C1=C(C(=CC(=C1I)N)F)C#N |
InChI: | InChI=1S/C7H4FIN2/c8-5-2-7(11)6(9)1-4(5)3-10/h1-2H,11H2 |
InChI Key: | WSDHSOHYAMHUIA-UHFFFAOYSA-N |
LogP: | 2.46538 |
Publication Number | Title | Priority Date |
CN-111032641-A | Substituted 5-cyanoindole compounds and uses thereof | 20170619 |
EP-3642195-A1 | Substituted 5-cyanoindole compounds and uses thereof | 20170619 |
TW-201904942-A | Substituted 5-cyanoguanidine compound and its use | 20170619 |
US-10604502-B2 | Substituted 5-cyanoindole compounds and uses thereof | 20170619 |
US-2019023684-A1 | Substituted 5-cyanoindole compounds and uses thereof | 20170619 |
Complexity: | 188 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 261.94032 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 261.94032 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 49.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS