4-Amino-2-chloro-6-morpholinopyridine - CAS 878809-77-9
Catalog: |
BB038669 |
Product Name: |
4-Amino-2-chloro-6-morpholinopyridine |
CAS: |
878809-77-9 |
Synonyms: |
2-chloro-6-(4-morpholinyl)-4-pyridinamine; 2-chloro-6-morpholin-4-ylpyridin-4-amine |
IUPAC Name: | 2-chloro-6-morpholin-4-ylpyridin-4-amine |
Description: | 4-Amino-2-chloro-6-morpholinopyridine (CAS# 878809-77-9) is a useful research chemical. |
Molecular Weight: | 213.66 |
Molecular Formula: | C9H12ClN3O |
Canonical SMILES: | C1COCCN1C2=NC(=CC(=C2)N)Cl |
InChI: | InChI=1S/C9H12ClN3O/c10-8-5-7(11)6-9(12-8)13-1-3-14-4-2-13/h5-6H,1-4H2,(H2,11,12) |
InChI Key: | MQMWPHZNMJNGAY-UHFFFAOYSA-N |
LogP: | 1.80000 |
Publication Number | Title | Priority Date |
US-2021147386-A1 | Pyrrolidine and piperidine compounds | 20191106 |
WO-2021090245-A1 | Pyrrolidine and piperidine compounds | 20191106 |
EP-2822943-A1 | Phosphoinositide 3-kinase inhibitors | 20120308 |
EP-2822943-B1 | Phosphoinositide 3-kinase inhibitors | 20120308 |
US-10035785-B2 | Phosphoinositide 3-kinase inhibitors | 20120308 |
Complexity: | 187 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.0668897 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.0668897 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 51.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS