4-Amino-2,3-dimethylpyridine - CAS 122475-57-4
Catalog: |
BB005404 |
Product Name: |
4-Amino-2,3-dimethylpyridine |
CAS: |
122475-57-4 |
Synonyms: |
2,3-dimethyl-4-pyridinamine; 2,3-dimethylpyridin-4-amine |
IUPAC Name: | 2,3-dimethylpyridin-4-amine |
Description: | 2,3-Dimethyl-4-pyridinamine, can be used in the synthesis of various compounds, such as polymethylated γ-carbolines having potent anti-bovine viral diarrhea virus (BVDV) activity. |
Molecular Weight: | 122.17 |
Molecular Formula: | C7H10N2 |
Canonical SMILES: | CC1=C(C=CN=C1C)N |
InChI: | InChI=1S/C7H10N2/c1-5-6(2)9-4-3-7(5)8/h3-4H,1-2H3,(H2,8,9) |
InChI Key: | YHUUZKCUQVILTK-UHFFFAOYSA-N |
Boiling Point: | 269 °C at 760 mmHg |
Density: | 1.039 g/cm3 |
Storage: | Keep in dark place, Inert atmosphere, 2-8 °C |
LogP: | 1.21070 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021127333-A1 | Trpml modulators | 20191219 |
WO-2021127337-A1 | Trpml modulators | 20191219 |
WO-2021125229-A1 | Indazole compound or salt thereof, and pharmaceutical composition | 20191217 |
WO-2021112092-A1 | Polymer composition, liquid crystal aligining agent, liquid crystal alignment film, liquid crystal display element, and method for producing liquid crystal display element | 20191206 |
WO-2021112251-A1 | Azetidine sulfonamide compound | 20191206 |
Complexity: | 92.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 122.084398327 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 122.084398327 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
-
[120739-62-0]
N-[(6-Chloropyridin-3-yl)methyl]-N-methylamine
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[37793-53-6]
N10-(Trifluoroacetyl)pteroic acid
-
[91-04-3]
2,6-Bis(hydroxymethyl)-p-cresol
-
[2874-73-9]
2,2-dimethyldodecanoic Acid
-
[92-06-8]
m-Terphenyl
INDUSTRY LEADERS TRUST OUR PRODUCTS