4-Amino-1,3-dimethylpyrazole Hydrochloride - CAS 1147222-02-3
Catalog: |
BB003420 |
Product Name: |
4-Amino-1,3-dimethylpyrazole Hydrochloride |
CAS: |
1147222-02-3 |
Synonyms: |
1,3-dimethyl-4-pyrazolamine;hydrochloride; 1,3-dimethylpyrazol-4-amine;hydrochloride |
IUPAC Name: | 1,3-dimethylpyrazol-4-amine;hydrochloride |
Description: | 4-Amino-1,3-dimethylpyrazole Hydrochloride (CAS# 1147222-02-3) is a useful research chemical. |
Molecular Weight: | 147.61 |
Molecular Formula: | C5H10ClN3 |
Canonical SMILES: | CC1=NN(C=C1N)C.Cl |
InChI: | InChI=1S/C5H9N3.ClH/c1-4-5(6)3-8(2)7-4;/h3H,6H2,1-2H3;1H |
InChI Key: | ZDOGXPGAEYKUJK-UHFFFAOYSA-N |
Storage: | Sealed in dry, Room Temperature |
MDL: | MFCD02253769 |
LogP: | 1.69390 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2016284402-A1 | Brk inhibitory compound | 20150622 |
AU-2016284402-B2 | Brk inhibitory compound | 20150622 |
CA-2990145-A1 | Brk inhibitory compound | 20150622 |
EP-3312182-A1 | Brk inhibitory compound | 20150622 |
JP-WO2016208595-A1 | Brk inhibitor compound | 20150622 |
Complexity: | 83.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 147.0563250 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 147.0563250 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS