4-Acetyl-3-fluoropyridine - CAS 87674-21-3
Catalog: |
BB038590 |
Product Name: |
4-Acetyl-3-fluoropyridine |
CAS: |
87674-21-3 |
Synonyms: |
1-(3-fluoro-4-pyridinyl)ethanone; 1-(3-fluoropyridin-4-yl)ethanone |
IUPAC Name: | 1-(3-fluoropyridin-4-yl)ethanone |
Description: | 4-Acetyl-3-fluoropyridine (CAS# 87674-21-3) is a useful research chemical. |
Molecular Weight: | 139.13 |
Molecular Formula: | C7H6FNO |
Canonical SMILES: | CC(=O)C1=C(C=NC=C1)F |
InChI: | InChI=1S/C7H6FNO/c1-5(10)6-2-3-9-4-7(6)8/h2-4H,1H3 |
InChI Key: | PPULDLJGJZUOBS-UHFFFAOYSA-N |
Boiling Point: | 199 ℃ |
Density: | 1.175 g/cm3 |
MDL: | MFCD07375077 |
LogP: | 1.42330 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111244543-A | High-voltage lithium ion battery electrolyte additive, electrolyte, battery and formation method thereof | 20200115 |
JP-2019011367-A | Method for producing optically active secondary alcohol | 20181012 |
EP-3628669-A1 | Novel compounds as nadph oxidase inhibitors | 20180928 |
TW-201945361-A | Novel GPR119 agonist compounds | 20160408 |
TW-I678367-B | Novel GPR119 agonist compounds | 20160408 |
Complexity: | 138 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 139.043341977 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 139.043341977 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS