4,8-Dichloroquinazoline - CAS 7148-34-7
Catalog: |
BB034392 |
Product Name: |
4,8-Dichloroquinazoline |
CAS: |
7148-34-7 |
Synonyms: |
4,8-dichloroquinazoline; 4,8-dichloroquinazoline |
IUPAC Name: | 4,8-dichloroquinazoline |
Description: | 4,8-Dichloroquinazoline (CAS# 7148-34-7) is a useful research chemical. |
Molecular Weight: | 199.04 |
Molecular Formula: | C8H4Cl2N2 |
Canonical SMILES: | C1=CC2=C(C(=C1)Cl)N=CN=C2Cl |
InChI: | InChI=1S/C8H4Cl2N2/c9-6-3-1-2-5-7(6)11-4-12-8(5)10/h1-4H |
InChI Key: | LGRUYTZVYJCUTH-UHFFFAOYSA-N |
Boiling Point: | 317.6 °C at 760 mmHg |
Density: | 1.486 g/cm3 |
MDL: | MFCD06657224 |
LogP: | 2.93660 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P310, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2020352942-A1 | Dosage forms and regimens for amino acid compounds | 20190408 |
WO-2020210404-A1 | Dosage forms and regimens for amino acid compounds | 20190408 |
TW-201938158-A | Amino acid compound and method of use | 20180307 |
US-2019276449-A1 | Amino acid compounds and methods of use | 20180307 |
WO-2019173653-A1 | Amino acid compounds and methods of use | 20180307 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 197.9751535 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 197.9751535 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS