4,7-Dichloro-6-methoxyquinazoline - CAS 55496-51-0
Catalog: |
BB029056 |
Product Name: |
4,7-Dichloro-6-methoxyquinazoline |
CAS: |
55496-51-0 |
Synonyms: |
4,7-dichloro-6-methoxyquinazoline; 4,7-dichloro-6-methoxyquinazoline |
IUPAC Name: | 4,7-dichloro-6-methoxyquinazoline |
Description: | 4,7-Dichloro-6-methoxyquinazoline (CAS# 55496-51-0) is a useful research chemical. |
Molecular Weight: | 229.06 |
Molecular Formula: | C9H6Cl2N2O |
Canonical SMILES: | COC1=C(C=C2C(=C1)C(=NC=N2)Cl)Cl |
InChI: | InChI=1S/C9H6Cl2N2O/c1-14-8-2-5-7(3-6(8)10)12-4-13-9(5)11/h2-4H,1H3 |
InChI Key: | ZYPYZZMHOIUNOS-UHFFFAOYSA-N |
LogP: | 2.94520 |
Publication Number | Title | Priority Date |
EP-0635498-A1 | Quinazoline derivatives and their use as anti-cancer agents | 19930719 |
EP-0635498-B1 | Quinazoline derivatives and their use as anti-cancer agents | 19930719 |
JP-3545763-B2 | Quinazoline derivatives and their use as anticancer agents | 19930719 |
JP-H09500636-A | Quinazoline derivatives and their use as anticancer agents | 19930719 |
PT-635498-E | Quinazoline derivatives and their use as anti-cancer agents | 19930719 |
Complexity: | 205 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 227.9857182 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 227.9857182 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS