4,6-Dichloro-2-methyl-2H-pyrazolo[3,4-d]pyrimidine - CAS 959432-77-0
Catalog: |
BB062752 |
Product Name: |
4,6-Dichloro-2-methyl-2H-pyrazolo[3,4-d]pyrimidine |
CAS: |
959432-77-0 |
Synonyms: |
4,6-dichloro-2-methyl-2h-pyrazolo[3,4-d]pyrimidine; 4,6-dichloro-2-methylpyrazolo[3,4-d]pyrimidine |
IUPAC Name: | 4,6-dichloro-2-methylpyrazolo[3,4-d]pyrimidine |
Description: | 4,6-Dichloro-2-methyl-2H-pyrazolo[3,4-d]pyrimidine is a useful research chemical compound. |
Molecular Weight: | 203 |
Molecular Formula: | C6H4Cl2N4 |
Canonical SMILES: | CN1C=C2C(=N1)N=C(N=C2Cl)Cl |
InChI: | InChI=1S/C6H4Cl2N4/c1-12-2-3-4(7)9-6(8)10-5(3)11-12/h2H,1H3 |
InChI Key: | QLHBOALBAOKBJV-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2021171543-A1 | Mcl1 inhibitors | 20191112 |
WO-2021096860-A1 | Mcl1 inhibitors | 20191112 |
TW-202128714-A | Mcl1 inhibitors | 20191112 |
EP-3647313-A1 | Substituted aryl ether compound, preparation method therefor, pharmaceutical composition and use thereof | 20170630 |
US-2020123162-A1 | Substituted aryl ether compound, preparation method thereof, pharmaceutical composition and use thereof | 20170630 |
AU-2007322382-A1 | Substituted pyrazolopyrimidines | 20060515 |
AU-2007322382-B2 | Substituted pyrazolopyrimidines | 20060515 |
CA-2650227-A1 | Substituted pyrazolopyrimidines | 20060515 |
CA-2650227-C | Substituted pyrazolopyrimidines | 20060515 |
EP-2024360-A2 | Substituted pyrazolopyrimidines | 20060515 |
Complexity: | 179 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.9813015 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.9813015 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.6Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS