4-(5-Ethynyl-2-pyridyl)morpholine - CAS 454685-29-1
Catalog: |
BB025876 |
Product Name: |
4-(5-Ethynyl-2-pyridyl)morpholine |
CAS: |
454685-29-1 |
Synonyms: |
4-(5-ethynyl-2-pyridinyl)morpholine; 4-(5-ethynylpyridin-2-yl)morpholine |
IUPAC Name: | 4-(5-ethynylpyridin-2-yl)morpholine |
Description: | 4-(5-Ethynyl-2-pyridyl)morpholine (CAS# 454685-29-1 ) is a useful research chemical. |
Molecular Weight: | 188.23 |
Molecular Formula: | C11H12N2O |
Canonical SMILES: | C#CC1=CN=C(C=C1)N2CCOCC2 |
InChI: | InChI=1S/C11H12N2O/c1-2-10-3-4-11(12-9-10)13-5-7-14-8-6-13/h1,3-4,9H,5-8H2 |
InChI Key: | IVVJUPPDIYSSEG-UHFFFAOYSA-N |
LogP: | 0.96450 |
Publication Number | Title | Priority Date |
WO-2020121261-A1 | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
WO-2020121263-A1 | Triazolopyridin-3-ones or their salts and pharmaceutical compositions comprising the same | 20181214 |
US-2020223827-A1 | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
US-2020223844-A1 | Triazolopyridin-3-ones or their salts and pharmaceutical compositions comprising the same | 20181214 |
TW-202039447-A | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
Complexity: | 227 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 188.094963011 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 188.094963011 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 25.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Morpholines/Thiomorpholines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS